About 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide
2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide (PubChem CID 115880901) has the molecular formula C14H16ClF2NO
and a molecular weight of 287.74 g/mol. Its IUPAC name is 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide |
| PubChem CID | 115880901 |
| Molecular Formula | C14H16ClF2NO |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide |
| SMILES | CC1(C)CCC(NC(=O)c2cc(F)c(F)cc2Cl)C1 |
| InChI | InChI=1S/C14H16ClF2NO/c1-14(2)4-3-8(7-14)18-13(19)9-5-11(16)12(17)6-10(9)15/h5-6,8H,3-4,7H2,1-2H3,(H,18,19) |
| InChIKey | MLQSBTXLHPOURO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide?
The IUPAC name of 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide (CID 115880901) is 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide.
What is the SMILES notation for 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide?
The canonical SMILES for 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide is CC1(C)CCC(NC(=O)c2cc(F)c(F)cc2Cl)C1.
What is the InChIKey of 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide?
The InChIKey is MLQSBTXLHPOURO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClF2NO/c1-14(2)4-3-8(7-14)18-13(19)9-5-11(16)12(17)6-10(9)15/h5-6,8H,3-4,7H2,1-2H3,(H,18,19).
What are the key properties of 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide?
2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide has a molecular weight of 287.74 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3,3-dimethylcyclopentyl)-4,5-difluorobenzamide is sourced from PubChem (CID 115880901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).