C12H13ClF2N2O — CID 119388800
2-chloro-4,5-difluoro-N-piperidin-4-ylbenzamide (PubChem CID 119388800) has the molecular formula C12H13ClF2N2O and a molecular weight of 274.70 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-piperidin-4-ylbenzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 119388800 |
| Molecular Formula | C12H13ClF2N2O |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-piperidin-4-ylbenzamide |
| SMILES | O=C(NC1CCNCC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C12H13ClF2N2O/c13-9-6-11(15)10(14)5-8(9)12(18)17-7-1-3-16-4-2-7/h5-7,16H,1-4H2,(H,17,18) |
| InChIKey | CYTHJECTIRXGKC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|