C13H15F3N2O2 — CID 107172249
N-(azepan-4-yl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 107172249) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is N-(azepan-4-yl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(azepan-4-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 107172249 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-(azepan-4-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | O=C(NC1CCCNCC1)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C13H15F3N2O2/c14-9-6-8(10(15)12(19)11(9)16)13(20)18-7-2-1-4-17-5-3-7/h6-7,17,19H,1-5H2,(H,18,20) |
| InChIKey | FKIYTXZFBLKPIM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|