C10H9F3N2O2 — CID 66187235
N-(azetidin-3-yl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 66187235) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is N-(azetidin-3-yl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(azetidin-3-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 66187235 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-(azetidin-3-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | O=C(NC1CNC1)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C10H9F3N2O2/c11-6-1-5(7(12)9(16)8(6)13)10(17)15-4-2-14-3-4/h1,4,14,16H,2-3H2,(H,15,17) |
| InChIKey | PMMUQVZJPZHERW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|