C14H15F3N2O2 — CID 43595596
(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone (PubChem CID 43595596) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is (2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone.
| Compound Name | (2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 43595596 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
| SMILES | CC1CC2CNCC2N1C(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C14H15F3N2O2/c1-6-2-7-4-18-5-10(7)19(6)14(21)8-3-9(15)12(17)13(20)11(8)16/h3,6-7,10,18,20H,2,4-5H2,1H3 |
| InChIKey | YHSRLQAHVSOQBV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|