C13H13BrF3NO2 — CID 106366436
N-[2-(bromomethyl)cyclopentyl]-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 106366436) has the molecular formula C13H13BrF3NO2 and a molecular weight of 352.15 g/mol. Its IUPAC name is N-[2-(bromomethyl)cyclopentyl]-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-[2-(bromomethyl)cyclopentyl]-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 106366436 |
| Molecular Formula | C13H13BrF3NO2 |
| Molecular Weight | 352.15 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | N-[2-(bromomethyl)cyclopentyl]-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | O=C(NC1CCCC1CBr)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C13H13BrF3NO2/c14-5-6-2-1-3-9(6)18-13(20)7-4-8(15)11(17)12(19)10(7)16/h4,6,9,19H,1-3,5H2,(H,18,20) |
| InChIKey | SGMWSOBKWQFFSQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|