C13H15BrClNO2 — CID 106366538
N-[2-(bromomethyl)cyclopentyl]-4-chloro-2-hydroxybenzamide (PubChem CID 106366538) has the molecular formula C13H15BrClNO2 and a molecular weight of 332.63 g/mol. Its IUPAC name is N-[2-(bromomethyl)cyclopentyl]-4-chloro-2-hydroxybenzamide.
| Compound Name | N-[2-(bromomethyl)cyclopentyl]-4-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 106366538 |
| Molecular Formula | C13H15BrClNO2 |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | N-[2-(bromomethyl)cyclopentyl]-4-chloro-2-hydroxybenzamide |
| SMILES | O=C(NC1CCCC1CBr)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C13H15BrClNO2/c14-7-8-2-1-3-11(8)16-13(18)10-5-4-9(15)6-12(10)17/h4-6,8,11,17H,1-3,7H2,(H,16,18) |
| InChIKey | BSOQJSJINYKJKI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|