C13H16BrNO3 — CID 106366292
N-[2-(bromomethyl)cyclopentyl]-2,4-dihydroxybenzamide (PubChem CID 106366292) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is N-[2-(bromomethyl)cyclopentyl]-2,4-dihydroxybenzamide.
| Compound Name | N-[2-(bromomethyl)cyclopentyl]-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 106366292 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | N-[2-(bromomethyl)cyclopentyl]-2,4-dihydroxybenzamide |
| SMILES | O=C(NC1CCCC1CBr)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H16BrNO3/c14-7-8-2-1-3-11(8)15-13(18)10-5-4-9(16)6-12(10)17/h4-6,8,11,16-17H,1-3,7H2,(H,15,18) |
| InChIKey | HRIWANYVNYSEJY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|