C11H12BrCl2NOS — CID 106366353
N-[2-(bromomethyl)cyclopentyl]-2,5-dichlorothiophene-3-carboxamide (PubChem CID 106366353) has the molecular formula C11H12BrCl2NOS and a molecular weight of 357.10 g/mol. Its IUPAC name is N-[2-(bromomethyl)cyclopentyl]-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-[2-(bromomethyl)cyclopentyl]-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 106366353 |
| Molecular Formula | C11H12BrCl2NOS |
| Molecular Weight | 357.10 g/mol |
| Exact Mass | 354.92 |
| IUPAC Name | N-[2-(bromomethyl)cyclopentyl]-2,5-dichlorothiophene-3-carboxamide |
| SMILES | O=C(NC1CCCC1CBr)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H12BrCl2NOS/c12-5-6-2-1-3-8(6)15-11(16)7-4-9(13)17-10(7)14/h4,6,8H,1-3,5H2,(H,15,16) |
| InChIKey | VYZYYASFBUGKFI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.10 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|