C12H14BrCl2NOS — CID 107966231
N-(2-bromocycloheptyl)-2,5-dichlorothiophene-3-carboxamide (PubChem CID 107966231) has the molecular formula C12H14BrCl2NOS and a molecular weight of 371.13 g/mol. Its IUPAC name is N-(2-bromocycloheptyl)-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-(2-bromocycloheptyl)-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107966231 |
| Molecular Formula | C12H14BrCl2NOS |
| Molecular Weight | 371.13 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | N-(2-bromocycloheptyl)-2,5-dichlorothiophene-3-carboxamide |
| SMILES | O=C(NC1CCCCCC1Br)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H14BrCl2NOS/c13-8-4-2-1-3-5-9(8)16-12(17)7-6-10(14)18-11(7)15/h6,8-9H,1-5H2,(H,16,17) |
| InChIKey | UNCSGNZMCRGWFK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.13 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|