C14H18BrNO3 — CID 107706124
N-(2-bromocycloheptyl)-3,5-dihydroxybenzamide (PubChem CID 107706124) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is N-(2-bromocycloheptyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(2-bromocycloheptyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107706124 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-(2-bromocycloheptyl)-3,5-dihydroxybenzamide |
| SMILES | O=C(NC1CCCCCC1Br)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H18BrNO3/c15-12-4-2-1-3-5-13(12)16-14(19)9-6-10(17)8-11(18)7-9/h6-8,12-13,17-18H,1-5H2,(H,16,19) |
| InChIKey | NJPCTDUEIQMOEJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|