C14H18BrNO3 — CID 80661734
N-(2-bromocyclopentyl)-3,5-dimethoxybenzamide (PubChem CID 80661734) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is N-(2-bromocyclopentyl)-3,5-dimethoxybenzamide.
| Compound Name | N-(2-bromocyclopentyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 80661734 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-(2-bromocyclopentyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC2CCCC2Br)c1 |
| InChI | InChI=1S/C14H18BrNO3/c1-18-10-6-9(7-11(8-10)19-2)14(17)16-13-5-3-4-12(13)15/h6-8,12-13H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | BMMUKGXVQXFZIY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|