C18H22N2O5S — CID 35569327
N-[(1S,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-3,5-dimethoxybenzamide (PubChem CID 35569327) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[(1S,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(1S,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 35569327 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[(1S,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N[C@H]2CCCC[C@@H]2N2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C18H22N2O5S/c1-24-12-7-11(8-13(9-12)25-2)17(22)19-14-5-3-4-6-15(14)20-16(21)10-26-18(20)23/h7-9,14-15H,3-6,10H2,1-2H3,(H,19,22)/t14-,15-/m0/s1 |
| InChIKey | JNDUFOCMZTUSAG-GJZGRUSLSA-N |
| XLogP | 2.44 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|