C19H18N2O5S — CID 35569569
N-[(1S,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-2-oxochromene-3-carboxamide (PubChem CID 35569569) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is N-[(1S,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(1S,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 35569569 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[(1S,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@H]1N1C(=O)CSC1=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H18N2O5S/c22-16-10-27-19(25)21(16)14-7-3-2-6-13(14)20-17(23)12-9-11-5-1-4-8-15(11)26-18(12)24/h1,4-5,8-9,13-14H,2-3,6-7,10H2,(H,20,23)/t13-,14+/m0/s1 |
| InChIKey | LPCHICKFFYTCDW-UONOGXRCSA-N |
| XLogP | 2.53 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|