C17H13NO3S — CID 110741738
2-oxo-N-(2-thiophen-2-ylcyclopropyl)chromene-3-carboxamide (PubChem CID 110741738) has the molecular formula C17H13NO3S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-oxo-N-(2-thiophen-2-ylcyclopropyl)chromene-3-carboxamide.
| Compound Name | 2-oxo-N-(2-thiophen-2-ylcyclopropyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 110741738 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-oxo-N-(2-thiophen-2-ylcyclopropyl)chromene-3-carboxamide |
| SMILES | O=C(NC1CC1c1cccs1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C17H13NO3S/c19-16(18-13-9-11(13)15-6-3-7-22-15)12-8-10-4-1-2-5-14(10)21-17(12)20/h1-8,11,13H,9H2,(H,18,19) |
| InChIKey | VLZMVWSEWAXURE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|