C15H13NO3S — CID 110741734
N-(2-thiophen-2-ylcyclopropyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 110741734) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(2-thiophen-2-ylcyclopropyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(2-thiophen-2-ylcyclopropyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 110741734 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-(2-thiophen-2-ylcyclopropyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC1CC1c1cccs1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13NO3S/c17-15(9-3-4-12-13(6-9)19-8-18-12)16-11-7-10(11)14-2-1-5-20-14/h1-6,10-11H,7-8H2,(H,16,17) |
| InChIKey | SGFGLZYQCZGHDR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |