C24H22N2O4 — CID 171722189
N-[2-(1-benzofuran-2-carbonylamino)cyclohexyl]-1-benzofuran-2-carboxamide (PubChem CID 171722189) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[2-(1-benzofuran-2-carbonylamino)cyclohexyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(1-benzofuran-2-carbonylamino)cyclohexyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 171722189 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-[2-(1-benzofuran-2-carbonylamino)cyclohexyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC1CCCCC1NC(=O)c1cc2ccccc2o1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C24H22N2O4/c27-23(21-13-15-7-1-5-11-19(15)29-21)25-17-9-3-4-10-18(17)26-24(28)22-14-16-8-2-6-12-20(16)30-22/h1-2,5-8,11-14,17-18H,3-4,9-10H2,(H,25,27)(H,26,28) |
| InChIKey | HELJEYNXELECJG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |