C16H18ClNO4 — CID 155990029
5-chloro-N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-1-benzofuran-2-carboxamide (PubChem CID 155990029) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is 5-chloro-N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 155990029 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 5-chloro-N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H](O)[C@@H]1O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C16H18ClNO4/c17-10-5-6-13-9(7-10)8-14(22-13)16(21)18-11-3-1-2-4-12(19)15(11)20/h5-8,11-12,15,19-20H,1-4H2,(H,18,21)/t11-,12+,15+/m0/s1 |
| InChIKey | FJMHARGVWBPRRA-YWPYICTPSA-N |
| XLogP | 2.48 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |