C17H20ClNO2 — CID 71662787
5-chloro-N-cyclooctyl-1-benzofuran-2-carboxamide (PubChem CID 71662787) has the molecular formula C17H20ClNO2 and a molecular weight of 305.80 g/mol. Its IUPAC name is 5-chloro-N-cyclooctyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-cyclooctyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 71662787 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-chloro-N-cyclooctyl-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C17H20ClNO2/c18-13-8-9-15-12(10-13)11-16(21-15)17(20)19-14-6-4-2-1-3-5-7-14/h8-11,14H,1-7H2,(H,19,20) |
| InChIKey | SBTRSJXIVBEZNS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |