C19H19ClN2O2 — CID 3618281
7-chloro-N-cycloheptylfuro[2,3-b]quinoline-2-carboxamide (PubChem CID 3618281) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 7-chloro-N-cycloheptylfuro[2,3-b]quinoline-2-carboxamide.
| Compound Name | 7-chloro-N-cycloheptylfuro[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 3618281 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 7-chloro-N-cycloheptylfuro[2,3-b]quinoline-2-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1cc2cc3ccc(Cl)cc3nc2o1 |
| InChI | InChI=1S/C19H19ClN2O2/c20-14-8-7-12-9-13-10-17(24-19(13)22-16(12)11-14)18(23)21-15-5-3-1-2-4-6-15/h7-11,15H,1-6H2,(H,21,23) |
| InChIKey | DRRVKJVXWIXVSF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |