C17H20N2O2 — CID 43603784
N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1-benzofuran-2-carboxamide (PubChem CID 43603784) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 43603784 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC1CC[C@H]2CNC[C@H]2C1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H20N2O2/c20-17(16-8-11-3-1-2-4-15(11)21-16)19-14-6-5-12-9-18-10-13(12)7-14/h1-4,8,12-14,18H,5-7,9-10H2,(H,19,20)/t12-,13+,14?/m0/s1 |
| InChIKey | HEGYTGUGOYYMBV-WLDKUNSKSA-N |
| XLogP | 2.55 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |