C19H22N2O3 — CID 154823074
N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-benzofuran-2-carboxamide (PubChem CID 154823074) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 154823074 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CO[C@@H](C3CC3)CN2C1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H22N2O3/c22-19(17-7-13-3-1-2-4-16(13)24-17)20-14-8-15-11-23-18(12-5-6-12)10-21(15)9-14/h1-4,7,12,14-15,18H,5-6,8-11H2,(H,20,22)/t14-,15+,18-/m1/s1 |
| InChIKey | JWLWASSYCDFKCR-RVKKMQEKSA-N |
| XLogP | 2.41 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |