C17H24N4O2 — CID 155493910
N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(methylamino)pyridine-3-carboxamide (PubChem CID 155493910) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(methylamino)pyridine-3-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155493910 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(methylamino)pyridine-3-carboxamide |
| SMILES | CNc1ncccc1C(=O)N[C@H]1C[C@H]2CO[C@@H](C3CC3)CN2C1 |
| InChI | InChI=1S/C17H24N4O2/c1-18-16-14(3-2-6-19-16)17(22)20-12-7-13-10-23-15(11-4-5-11)9-21(13)8-12/h2-3,6,11-13,15H,4-5,7-10H2,1H3,(H,18,19)(H,20,22)/t12-,13-,15+/m0/s1 |
| InChIKey | RNIYTLPRWKCHIL-KCQAQPDRSA-N |
| XLogP | 1.10 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |