C25H30N2O2 — CID 154817388
N-[(3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-[(4-methylphenyl)methyl]benzamide (PubChem CID 154817388) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[(3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-[(4-methylphenyl)methyl]benzamide.
| Compound Name | N-[(3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 154817388 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[(3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-[(4-methylphenyl)methyl]benzamide |
| SMILES | Cc1ccc(Cc2ccccc2C(=O)N[C@@H]2C[C@H]3CO[C@H](C4CC4)CN3C2)cc1 |
| InChI | InChI=1S/C25H30N2O2/c1-17-6-8-18(9-7-17)12-20-4-2-3-5-23(20)25(28)26-21-13-22-16-29-24(19-10-11-19)15-27(22)14-21/h2-9,19,21-22,24H,10-16H2,1H3,(H,26,28)/t21-,22+,24+/m1/s1 |
| InChIKey | MAIAHUVMCOJTLB-GPXNEJASSA-N |
| XLogP | 3.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |