C17H23N3O2 — CID 154818688
1-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-phenylurea (PubChem CID 154818688) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-phenylurea.
| Compound Name | 1-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-phenylurea |
|---|---|
| PubChem CID | 154818688 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N[C@H]1C[C@H]2CO[C@@H](C3CC3)CN2C1 |
| InChI | InChI=1S/C17H23N3O2/c21-17(18-13-4-2-1-3-5-13)19-14-8-15-11-22-16(12-6-7-12)10-20(15)9-14/h1-5,12,14-16H,6-11H2,(H2,18,19,21)/t14-,15-,16+/m0/s1 |
| InChIKey | HFJRTDFFXARERN-HRCADAONSA-N |
| XLogP | 2.06 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |