C17H21ClFN3O2 — CID 155501113
1-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-chloro-4-fluorophenyl)urea (PubChem CID 155501113) has the molecular formula C17H21ClFN3O2 and a molecular weight of 353.83 g/mol. Its IUPAC name is 1-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-chloro-4-fluorophenyl)urea.
| Compound Name | 1-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-chloro-4-fluorophenyl)urea |
|---|---|
| PubChem CID | 155501113 |
| Molecular Formula | C17H21ClFN3O2 |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-chloro-4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)N[C@@H]1C[C@H]2CO[C@@H](C3CC3)CN2C1 |
| InChI | InChI=1S/C17H21ClFN3O2/c18-14-6-11(3-4-15(14)19)20-17(23)21-12-5-13-9-24-16(10-1-2-10)8-22(13)7-12/h3-4,6,10,12-13,16H,1-2,5,7-9H2,(H2,20,21,23)/t12-,13+,16-/m1/s1 |
| InChIKey | GBUQSDDCQLVPSA-DVOMOZLQSA-N |
| XLogP | 2.85 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |