C16H22ClN3O2 — CID 155498559
1-[(3R,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-chloro-2-methylphenyl)urea (PubChem CID 155498559) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 1-[(3R,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-chloro-2-methylphenyl)urea.
| Compound Name | 1-[(3R,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-chloro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 155498559 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 1-[(3R,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-chloro-2-methylphenyl)urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)N[C@H]1C[C@H]2CO[C@H](C)CN2C1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-10-7-20-8-12(6-13(20)9-22-10)18-16(21)19-15-5-3-4-14(17)11(15)2/h3-5,10,12-13H,6-9H2,1-2H3,(H2,18,19,21)/t10-,12+,13+/m1/s1 |
| InChIKey | WHWRCLFHFAAFLS-WXHSDQCUSA-N |
| XLogP | 2.63 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |