C21H25N3O3 — CID 154819930
1-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(4-phenoxyphenyl)urea (PubChem CID 154819930) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 154819930 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(4-phenoxyphenyl)urea |
| SMILES | C[C@@H]1CN2C[C@H](NC(=O)Nc3ccc(Oc4ccccc4)cc3)C[C@H]2CO1 |
| InChI | InChI=1S/C21H25N3O3/c1-15-12-24-13-17(11-18(24)14-26-15)23-21(25)22-16-7-9-20(10-8-16)27-19-5-3-2-4-6-19/h2-10,15,17-18H,11-14H2,1H3,(H2,22,23,25)/t15-,17-,18+/m1/s1 |
| InChIKey | CAVKNWFQQPSUTK-NXHRZFHOSA-N |
| XLogP | 3.46 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |