C22H26N2O3 — CID 154820224
N-[(3R,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(phenoxymethyl)benzamide (PubChem CID 154820224) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(3R,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(phenoxymethyl)benzamide.
| Compound Name | N-[(3R,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 154820224 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[(3R,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(phenoxymethyl)benzamide |
| SMILES | C[C@@H]1CN2C[C@@H](NC(=O)c3ccc(COc4ccccc4)cc3)C[C@H]2CO1 |
| InChI | InChI=1S/C22H26N2O3/c1-16-12-24-13-19(11-20(24)15-26-16)23-22(25)18-9-7-17(8-10-18)14-27-21-5-3-2-4-6-21/h2-10,16,19-20H,11-15H2,1H3,(H,23,25)/t16-,19+,20+/m1/s1 |
| InChIKey | BDMQYPNNOJUQCK-UXPWSPDFSA-N |
| XLogP | 2.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |