C18H21N3O2 — CID 155498681
N-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]quinoline-4-carboxamide (PubChem CID 155498681) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]quinoline-4-carboxamide.
| Compound Name | N-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 155498681 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]quinoline-4-carboxamide |
| SMILES | C[C@@H]1CN2C[C@H](NC(=O)c3ccnc4ccccc34)C[C@H]2CO1 |
| InChI | InChI=1S/C18H21N3O2/c1-12-9-21-10-13(8-14(21)11-23-12)20-18(22)16-6-7-19-17-5-3-2-4-15(16)17/h2-7,12-14H,8-11H2,1H3,(H,20,22)/t12-,13-,14+/m1/s1 |
| InChIKey | GUVIYNBRCJWKKJ-MCIONIFRSA-N |
| XLogP | 1.83 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |