C20H23N3O2 — CID 56883665
N-[(1R,3S)-3-(pyrrolidine-1-carbonyl)cyclopentyl]quinoline-4-carboxamide (PubChem CID 56883665) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(1R,3S)-3-(pyrrolidine-1-carbonyl)cyclopentyl]quinoline-4-carboxamide.
| Compound Name | N-[(1R,3S)-3-(pyrrolidine-1-carbonyl)cyclopentyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 56883665 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[(1R,3S)-3-(pyrrolidine-1-carbonyl)cyclopentyl]quinoline-4-carboxamide |
| SMILES | O=C(N[C@@H]1CC[C@H](C(=O)N2CCCC2)C1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C20H23N3O2/c24-19(17-9-10-21-18-6-2-1-5-16(17)18)22-15-8-7-14(13-15)20(25)23-11-3-4-12-23/h1-2,5-6,9-10,14-15H,3-4,7-8,11-13H2,(H,22,24)/t14-,15+/m0/s1 |
| InChIKey | MPIAZARCOBGQFB-LSDHHAIUSA-N |
| XLogP | 2.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |