C16H20F2N2O3 — CID 155508605
N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(difluoromethoxy)benzamide (PubChem CID 155508605) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(difluoromethoxy)benzamide.
| Compound Name | N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 155508605 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(difluoromethoxy)benzamide |
| SMILES | C[C@H]1CN2C[C@H](NC(=O)c3ccc(OC(F)F)cc3)C[C@H]2CO1 |
| InChI | InChI=1S/C16H20F2N2O3/c1-10-7-20-8-12(6-13(20)9-22-10)19-15(21)11-2-4-14(5-3-11)23-16(17)18/h2-5,10,12-13,16H,6-9H2,1H3,(H,19,21)/t10-,12+,13-/m0/s1 |
| InChIKey | QVWKQPUNUUDFNW-UHTWSYAYSA-N |
| XLogP | 1.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |