C16H19N3O2 — CID 155505913
N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzamide (PubChem CID 155505913) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzamide.
| Compound Name | N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 155505913 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzamide |
| SMILES | C[C@H]1CN2C[C@H](NC(=O)c3cccc(C#N)c3)C[C@H]2CO1 |
| InChI | InChI=1S/C16H19N3O2/c1-11-8-19-9-14(6-15(19)10-21-11)18-16(20)13-4-2-3-12(5-13)7-17/h2-5,11,14-15H,6,8-10H2,1H3,(H,18,20)/t11-,14+,15-/m0/s1 |
| InChIKey | IHBNLCMDZQMRTM-GLQYFDAESA-N |
| XLogP | 1.15 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |