C21H20ClN3O2 — CID 155501366
N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzamide (PubChem CID 155501366) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzamide.
| Compound Name | N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 155501366 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzamide |
| SMILES | N#Cc1cccc(C(=O)N[C@@H]2C[C@H]3CO[C@@H](c4ccc(Cl)cc4)CN3C2)c1 |
| InChI | InChI=1S/C21H20ClN3O2/c22-17-6-4-15(5-7-17)20-12-25-11-18(9-19(25)13-27-20)24-21(26)16-3-1-2-14(8-16)10-23/h1-8,18-20H,9,11-13H2,(H,24,26)/t18-,19+,20-/m1/s1 |
| InChIKey | CUHLFSGCDBSPLW-HSALFYBXSA-N |
| XLogP | 3.16 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |