C21H22ClN5O2 — CID 162631237
N-[(3S,7S,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-methylpyrazolo[4,5-b]pyridine-6-carboxamide (PubChem CID 162631237) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-methylpyrazolo[4,5-b]pyridine-6-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-methylpyrazolo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 162631237 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-[(3S,7S,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-methylpyrazolo[4,5-b]pyridine-6-carboxamide |
| SMILES | Cn1ncc2ncc(C(=O)N[C@H]3C[C@H]4CO[C@@H](c5ccc(Cl)cc5)CN4C3)cc21 |
| InChI | InChI=1S/C21H22ClN5O2/c1-26-19-6-14(8-23-18(19)9-24-26)21(28)25-16-7-17-12-29-20(11-27(17)10-16)13-2-4-15(22)5-3-13/h2-6,8-9,16-17,20H,7,10-12H2,1H3,(H,25,28)/t16-,17-,20+/m0/s1 |
| InChIKey | VWZPRRZCEHHRLG-ABSDTBQOSA-N |
| XLogP | 2.57 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |