C17H19ClN4O2S — CID 155497865
N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-1,3-thiazole-5-carboxamide (PubChem CID 155497865) has the molecular formula C17H19ClN4O2S and a molecular weight of 378.89 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155497865 |
| Molecular Formula | C17H19ClN4O2S |
| Molecular Weight | 378.89 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-1,3-thiazole-5-carboxamide |
| SMILES | Nc1ncc(C(=O)N[C@@H]2C[C@H]3CO[C@@H](c4ccc(Cl)cc4)CN3C2)s1 |
| InChI | InChI=1S/C17H19ClN4O2S/c18-11-3-1-10(2-4-11)14-8-22-7-12(5-13(22)9-24-14)21-16(23)15-6-20-17(19)25-15/h1-4,6,12-14H,5,7-9H2,(H2,19,20)(H,21,23)/t12-,13+,14-/m1/s1 |
| InChIKey | XOCOZAICDGRVLK-HZSPNIEDSA-N |
| XLogP | 2.32 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.89 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |