C16H22ClN3O4S — CID 154815764
N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(methanesulfonamido)acetamide (PubChem CID 154815764) has the molecular formula C16H22ClN3O4S and a molecular weight of 387.89 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(methanesulfonamido)acetamide.
| Compound Name | N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(methanesulfonamido)acetamide |
|---|---|
| PubChem CID | 154815764 |
| Molecular Formula | C16H22ClN3O4S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(methanesulfonamido)acetamide |
| SMILES | CS(=O)(=O)NCC(=O)N[C@@H]1C[C@H]2CO[C@@H](c3ccc(Cl)cc3)CN2C1 |
| InChI | InChI=1S/C16H22ClN3O4S/c1-25(22,23)18-7-16(21)19-13-6-14-10-24-15(9-20(14)8-13)11-2-4-12(17)5-3-11/h2-5,13-15,18H,6-10H2,1H3,(H,19,21)/t13-,14+,15-/m1/s1 |
| InChIKey | HTBJWPGWXGCEMD-QLFBSQMISA-N |
| XLogP | 0.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |