C20H27ClN2O3 — CID 155503568
N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(methoxymethyl)cyclobutane-1-carboxamide (PubChem CID 155503568) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(methoxymethyl)cyclobutane-1-carboxamide.
| Compound Name | N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(methoxymethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 155503568 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(methoxymethyl)cyclobutane-1-carboxamide |
| SMILES | COCC1(C(=O)N[C@@H]2C[C@H]3CO[C@@H](c4ccc(Cl)cc4)CN3C2)CCC1 |
| InChI | InChI=1S/C20H27ClN2O3/c1-25-13-20(7-2-8-20)19(24)22-16-9-17-12-26-18(11-23(17)10-16)14-3-5-15(21)6-4-14/h3-6,16-18H,2,7-13H2,1H3,(H,22,24)/t16-,17+,18-/m1/s1 |
| InChIKey | KAUDDOGYJKMALQ-FGTMMUONSA-N |
| XLogP | 2.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |