C23H25ClN2O2 — CID 154817084
N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(4-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 154817084) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(4-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(4-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 154817084 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(4-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CO[C@@H](c3ccccc3)CN2C1)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H25ClN2O2/c24-18-8-6-17(7-9-18)23(10-11-23)22(27)25-19-12-20-15-28-21(14-26(20)13-19)16-4-2-1-3-5-16/h1-9,19-21H,10-15H2,(H,25,27)/t19-,20+,21-/m1/s1 |
| InChIKey | XHWPPFOYYKHDJK-QHAWAJNXSA-N |
| XLogP | 3.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |