C19H28Cl3N3O2 — CID 163334006
(2S,5S)-N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methylpyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 163334006) has the molecular formula C19H28Cl3N3O2 and a molecular weight of 436.81 g/mol. Its IUPAC name is (2S,5S)-N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methylpyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | (2S,5S)-N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methylpyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 163334006 |
| Molecular Formula | C19H28Cl3N3O2 |
| Molecular Weight | 436.81 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (2S,5S)-N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methylpyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | C[C@H]1CC[C@@H](C(=O)N[C@@H]2C[C@H]3CO[C@@H](c4ccc(Cl)cc4)CN3C2)N1.Cl.Cl |
| InChI | InChI=1S/C19H26ClN3O2.2ClH/c1-12-2-7-17(21-12)19(24)22-15-8-16-11-25-18(10-23(16)9-15)13-3-5-14(20)6-4-13;;/h3-6,12,15-18,21H,2,7-11H2,1H3,(H,22,24);2*1H/t12-,15+,16-,17-,18+;;/m0../s1 |
| InChIKey | FYVWEJYGAVGXBJ-BKFQUJDOSA-N |
| XLogP | 2.95 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |