C23H29Cl2N3O2 — CID 163333714
(3R)-N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;dihydrochloride (PubChem CID 163333714) has the molecular formula C23H29Cl2N3O2 and a molecular weight of 450.41 g/mol. Its IUPAC name is (3R)-N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;dihydrochloride.
| Compound Name | (3R)-N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 163333714 |
| Molecular Formula | C23H29Cl2N3O2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (3R)-N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(N[C@@H]1C[C@H]2CO[C@@H](c3ccccc3)CN2C1)[C@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C23H27N3O2.2ClH/c27-23(21-10-17-8-4-5-9-18(17)12-24-21)25-19-11-20-15-28-22(14-26(20)13-19)16-6-2-1-3-7-16;;/h1-9,19-22,24H,10-15H2,(H,25,27);2*1H/t19-,20+,21-,22-;;/m1../s1 |
| InChIKey | SSQGTIHVDGFCCN-JJTFQUAHSA-N |
| XLogP | 2.88 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |