C19H26N4O3 — CID 155502661
(2S)-2-N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]pyrrolidine-1,2-dicarboxamide (PubChem CID 155502661) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (2S)-2-N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-2-N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 155502661 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (2S)-2-N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]pyrrolidine-1,2-dicarboxamide |
| SMILES | NC(=O)N1CCC[C@H]1C(=O)N[C@H]1C[C@H]2CO[C@@H](c3ccccc3)CN2C1 |
| InChI | InChI=1S/C19H26N4O3/c20-19(25)23-8-4-7-16(23)18(24)21-14-9-15-12-26-17(11-22(15)10-14)13-5-2-1-3-6-13/h1-3,5-6,14-17H,4,7-12H2,(H2,20,25)(H,21,24)/t14-,15-,16-,17+/m0/s1 |
| InChIKey | ROCXWSUWKKVEOX-LUKYLMHMSA-N |
| XLogP | 0.86 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |