C21H31N3O2 — CID 155506593
N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-[cyclopentyl(methyl)amino]acetamide (PubChem CID 155506593) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-[cyclopentyl(methyl)amino]acetamide.
| Compound Name | N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-[cyclopentyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 155506593 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-[cyclopentyl(methyl)amino]acetamide |
| SMILES | CN(CC(=O)N[C@@H]1C[C@H]2CO[C@@H](c3ccccc3)CN2C1)C1CCCC1 |
| InChI | InChI=1S/C21H31N3O2/c1-23(18-9-5-6-10-18)14-21(25)22-17-11-19-15-26-20(13-24(19)12-17)16-7-3-2-4-8-16/h2-4,7-8,17-20H,5-6,9-15H2,1H3,(H,22,25)/t17-,19+,20-/m1/s1 |
| InChIKey | KFPVLZXCTMLIOF-YZGWKJHDSA-N |
| XLogP | 2.19 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |