C19H26Cl3N5O2 — CID 163334134
(2S)-N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-3-(1H-imidazol-5-yl)propanamide;dihydrochloride (PubChem CID 163334134) has the molecular formula C19H26Cl3N5O2 and a molecular weight of 462.81 g/mol. Its IUPAC name is (2S)-N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-3-(1H-imidazol-5-yl)propanamide;dihydrochloride.
| Compound Name | (2S)-N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-3-(1H-imidazol-5-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 163334134 |
| Molecular Formula | C19H26Cl3N5O2 |
| Molecular Weight | 462.81 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | (2S)-N-[(3S,7R,8aS)-3-(4-chlorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-3-(1H-imidazol-5-yl)propanamide;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H]1C[C@H]2CO[C@@H](c3ccc(Cl)cc3)CN2C1 |
| InChI | InChI=1S/C19H24ClN5O2.2ClH/c20-13-3-1-12(2-4-13)18-9-25-8-15(5-16(25)10-27-18)24-19(26)17(21)6-14-7-22-11-23-14;;/h1-4,7,11,15-18H,5-6,8-10,21H2,(H,22,23)(H,24,26);2*1H/t15-,16+,17+,18-;;/m1../s1 |
| InChIKey | OXYLQDAILOCSNE-VDTIQGKFSA-N |
| XLogP | 2.11 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.81 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |