C18H27N3O3 — CID 154817674
N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(2-aminoethoxy)-4-methylbenzamide (PubChem CID 154817674) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(2-aminoethoxy)-4-methylbenzamide.
| Compound Name | N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(2-aminoethoxy)-4-methylbenzamide |
|---|---|
| PubChem CID | 154817674 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(2-aminoethoxy)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]2C[C@H]3CO[C@@H](C)CN3C2)cc1OCCN |
| InChI | InChI=1S/C18H27N3O3/c1-12-3-4-14(7-17(12)23-6-5-19)18(22)20-15-8-16-11-24-13(2)9-21(16)10-15/h3-4,7,13,15-16H,5-6,8-11,19H2,1-2H3,(H,20,22)/t13-,15+,16-/m0/s1 |
| InChIKey | PZDGAJKOEALJHR-IMJJTQAJSA-N |
| XLogP | 0.92 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |