C24H33Cl2N3O5 — CID 163334930
N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-[2-(aminomethyl)-3-methoxyphenoxy]-4-methoxybenzamide;dihydrochloride (PubChem CID 163334930) has the molecular formula C24H33Cl2N3O5 and a molecular weight of 514.45 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-[2-(aminomethyl)-3-methoxyphenoxy]-4-methoxybenzamide;dihydrochloride.
| Compound Name | N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-[2-(aminomethyl)-3-methoxyphenoxy]-4-methoxybenzamide;dihydrochloride |
|---|---|
| PubChem CID | 163334930 |
| Molecular Formula | C24H33Cl2N3O5 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-[2-(aminomethyl)-3-methoxyphenoxy]-4-methoxybenzamide;dihydrochloride |
| SMILES | COc1ccc(C(=O)N[C@H]2C[C@H]3CO[C@@H](C)CN3C2)cc1Oc1cccc(OC)c1CN.Cl.Cl |
| InChI | InChI=1S/C24H31N3O5.2ClH/c1-15-12-27-13-17(10-18(27)14-31-15)26-24(28)16-7-8-22(30-3)23(9-16)32-21-6-4-5-20(29-2)19(21)11-25;;/h4-9,15,17-18H,10-14,25H2,1-3H3,(H,26,28);2*1H/t15-,17-,18-;;/m0../s1 |
| InChIKey | GRNXWGCTUZBXKL-GWRZQJEISA-N |
| XLogP | 3.39 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |