C17H25N3O4 — CID 155509748
1-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3,4-dimethoxyphenyl)urea (PubChem CID 155509748) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3,4-dimethoxyphenyl)urea.
| Compound Name | 1-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 155509748 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N[C@H]2C[C@H]3CO[C@@H](C)CN3C2)cc1OC |
| InChI | InChI=1S/C17H25N3O4/c1-11-8-20-9-13(6-14(20)10-24-11)19-17(21)18-12-4-5-15(22-2)16(7-12)23-3/h4-5,7,11,13-14H,6,8-10H2,1-3H3,(H2,18,19,21)/t11-,13-,14-/m0/s1 |
| InChIKey | QHZATRTXKLUIHP-UBHSHLNASA-N |
| XLogP | 1.69 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |