C14H20N2O5 — CID 131911929
1-(3,4-dimethoxyphenyl)-3-[(3S,4R)-4-methoxyoxolan-3-yl]urea (PubChem CID 131911929) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[(3S,4R)-4-methoxyoxolan-3-yl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[(3S,4R)-4-methoxyoxolan-3-yl]urea |
|---|---|
| PubChem CID | 131911929 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[(3S,4R)-4-methoxyoxolan-3-yl]urea |
| SMILES | COc1ccc(NC(=O)N[C@H]2COC[C@@H]2OC)cc1OC |
| InChI | InChI=1S/C14H20N2O5/c1-18-11-5-4-9(6-12(11)19-2)15-14(17)16-10-7-21-8-13(10)20-3/h4-6,10,13H,7-8H2,1-3H3,(H2,15,16,17)/t10-,13-/m0/s1 |
| InChIKey | JHRGMUOKZCGEEK-GWCFXTLKSA-N |
| XLogP | 1.24 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |