C15H22N2O4 — CID 118778137
1-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-(3-methoxy-4-methylphenyl)urea (PubChem CID 118778137) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-(3-methoxy-4-methylphenyl)urea.
| Compound Name | 1-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-(3-methoxy-4-methylphenyl)urea |
|---|---|
| PubChem CID | 118778137 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-(3-methoxy-4-methylphenyl)urea |
| SMILES | CCO[C@H]1COC[C@@H]1NC(=O)Nc1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-4-21-14-9-20-8-12(14)17-15(18)16-11-6-5-10(2)13(7-11)19-3/h5-7,12,14H,4,8-9H2,1-3H3,(H2,16,17,18)/t12-,14-/m0/s1 |
| InChIKey | TYNCHXMGASEXQY-JSGCOSHPSA-N |
| XLogP | 1.93 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |