C17H28N4O3 — CID 156607637
1-(2-cyclohexyl-5-methylpyrazol-3-yl)-3-(4-ethoxyoxolan-3-yl)urea (PubChem CID 156607637) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-(2-cyclohexyl-5-methylpyrazol-3-yl)-3-(4-ethoxyoxolan-3-yl)urea.
| Compound Name | 1-(2-cyclohexyl-5-methylpyrazol-3-yl)-3-(4-ethoxyoxolan-3-yl)urea |
|---|---|
| PubChem CID | 156607637 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-(2-cyclohexyl-5-methylpyrazol-3-yl)-3-(4-ethoxyoxolan-3-yl)urea |
| SMILES | CCOC1COCC1NC(=O)Nc1cc(C)nn1C1CCCCC1 |
| InChI | InChI=1S/C17H28N4O3/c1-3-24-15-11-23-10-14(15)18-17(22)19-16-9-12(2)20-21(16)13-7-5-4-6-8-13/h9,13-15H,3-8,10-11H2,1-2H3,(H2,18,19,22) |
| InChIKey | MZDNUWUJITWEFA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |